Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Acetylcholine Chloride, 99%
CAS: 60-31-1 Molecular Formula: C7H16ClNO2 Molecular Weight (g/mol): 181.66 MDL Number: MFCD00011698 InChI Key: JUGOREOARAHOCO-UHFFFAOYSA-M Synonym: acetylcholine chloride,miochol,acecoline,chloroacetylcholine,arterocoline,acecholin,ovisot,ach chloride,azetylcholinchlorid,2-acetyloxy-n,n,n-trimethylethanaminium chloride PubChem CID: 6060 ChEBI: CHEBI:2417 IUPAC Name: 2-acetyloxyethyl(trimethyl)azanium;chloride SMILES: CC(=O)OCC[N+](C)(C)C.[Cl-]
| PubChem CID | 6060 |
|---|---|
| CAS | 60-31-1 |
| Molecular Weight (g/mol) | 181.66 |
| ChEBI | CHEBI:2417 |
| MDL Number | MFCD00011698 |
| SMILES | CC(=O)OCC[N+](C)(C)C.[Cl-] |
| Synonym | acetylcholine chloride,miochol,acecoline,chloroacetylcholine,arterocoline,acecholin,ovisot,ach chloride,azetylcholinchlorid,2-acetyloxy-n,n,n-trimethylethanaminium chloride |
| IUPAC Name | 2-acetyloxyethyl(trimethyl)azanium;chloride |
| InChI Key | JUGOREOARAHOCO-UHFFFAOYSA-M |
| Molecular Formula | C7H16ClNO2 |
1-Dodecanethiol, 98%, Thermo Scientific Chemicals
CAS: 112-55-0 Molecular Formula: C12H26S Molecular Weight (g/mol): 202.40 MDL Number: MFCD00004885 InChI Key: WNAHIZMDSQCWRP-UHFFFAOYSA-N Synonym: 1-dodecanethiol,dodecyl mercaptan,dodecanethiol,n-dodecanethiol,lauryl mercaptan,n-dodecyl mercaptan,n-dodecylmercaptan,1-mercaptododecane,n-lauryl mercaptan,1-dodecyl mercaptan PubChem CID: 8195 IUPAC Name: dodecane-1-thiol SMILES: CCCCCCCCCCCCS
| PubChem CID | 8195 |
|---|---|
| CAS | 112-55-0 |
| Molecular Weight (g/mol) | 202.40 |
| MDL Number | MFCD00004885 |
| SMILES | CCCCCCCCCCCCS |
| Synonym | 1-dodecanethiol,dodecyl mercaptan,dodecanethiol,n-dodecanethiol,lauryl mercaptan,n-dodecyl mercaptan,n-dodecylmercaptan,1-mercaptododecane,n-lauryl mercaptan,1-dodecyl mercaptan |
| IUPAC Name | dodecane-1-thiol |
| InChI Key | WNAHIZMDSQCWRP-UHFFFAOYSA-N |
| Molecular Formula | C12H26S |
2,2,2-Trifluoroethanol, 99.8%, extra pure
CAS: 75-89-8 Molecular Formula: C2H3F3O Molecular Weight (g/mol): 100.04 MDL Number: MFCD00004672 InChI Key: RHQDFWAXVIIEBN-UHFFFAOYSA-N Synonym: trifluoroethanol,ethanol, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-ol,fluorinol 85,2,2,2-trifluoroethyl alcohol,trifluoroethyl alcohol,trifluoro ethanol,tfe,perfluoro-1,1-dihydroethanol,tfetoh PubChem CID: 6409 ChEBI: CHEBI:42330 IUPAC Name: 2,2,2-trifluoroethanol SMILES: OCC(F)(F)F
| PubChem CID | 6409 |
|---|---|
| CAS | 75-89-8 |
| Molecular Weight (g/mol) | 100.04 |
| ChEBI | CHEBI:42330 |
| MDL Number | MFCD00004672 |
| SMILES | OCC(F)(F)F |
| Synonym | trifluoroethanol,ethanol, 2,2,2-trifluoro,2,2,2-trifluoroethan-1-ol,fluorinol 85,2,2,2-trifluoroethyl alcohol,trifluoroethyl alcohol,trifluoro ethanol,tfe,perfluoro-1,1-dihydroethanol,tfetoh |
| IUPAC Name | 2,2,2-trifluoroethanol |
| InChI Key | RHQDFWAXVIIEBN-UHFFFAOYSA-N |
| Molecular Formula | C2H3F3O |
3-Pentanone, 99%
CAS: 96-22-0 Molecular Formula: C5H10O Molecular Weight (g/mol): 86.13 MDL Number: MFCD00009320 InChI Key: FDPIMTJIUBPUKL-UHFFFAOYSA-N Synonym: 3-pentanone,diethyl ketone,propione,ethyl ketone,dimethylacetone,metacetone,methacetone,diethylcetone,ethyl propionyl,diethylketone PubChem CID: 7288 ChEBI: CHEBI:67886 IUPAC Name: pentan-3-one SMILES: CCC(=O)CC
| PubChem CID | 7288 |
|---|---|
| CAS | 96-22-0 |
| Molecular Weight (g/mol) | 86.13 |
| ChEBI | CHEBI:67886 |
| MDL Number | MFCD00009320 |
| SMILES | CCC(=O)CC |
| Synonym | 3-pentanone,diethyl ketone,propione,ethyl ketone,dimethylacetone,metacetone,methacetone,diethylcetone,ethyl propionyl,diethylketone |
| IUPAC Name | pentan-3-one |
| InChI Key | FDPIMTJIUBPUKL-UHFFFAOYSA-N |
| Molecular Formula | C5H10O |
Thermo Scientific Chemicals Rose Bengal
CAS: 632-69-9 Molecular Formula: C20H4Cl4I4Na2O5 Molecular Weight (g/mol): 1019.644 MDL Number: MFCD00151169 InChI Key: DPBQSRZQYAYDGY-UHFFFAOYSA-N Synonym: rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin PubChem CID: 87244310 IUPAC Name: sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na]
| PubChem CID | 87244310 |
|---|---|
| CAS | 632-69-9 |
| Molecular Weight (g/mol) | 1019.644 |
| MDL Number | MFCD00151169 |
| SMILES | C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na] |
| Synonym | rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin |
| IUPAC Name | sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | DPBQSRZQYAYDGY-UHFFFAOYSA-N |
| Molecular Formula | C20H4Cl4I4Na2O5 |
Tetra-n-butylammonium hydroxide, 1.0M in methanol
CAS: 2052-49-5 Molecular Formula: C16H37NO Molecular Weight (g/mol): 259.48 MDL Number: MFCD00009425 InChI Key: VDZOOKBUILJEDG-UHFFFAOYSA-M Synonym: tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 PubChem CID: 2723671 SMILES: [OH-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2723671 |
|---|---|
| CAS | 2052-49-5 |
| Molecular Weight (g/mol) | 259.48 |
| MDL Number | MFCD00009425 |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO |
L(-)-Glutathione, oxidized, 98%
CAS: 27025-41-8 Molecular Formula: C20H32N6O12S2 Molecular Weight (g/mol): 612.63 MDL Number: MFCD00150701 InChI Key: YPZRWBKMTBYPTK-IOKZUGQQNA-N Synonym: oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized PubChem CID: 65359 ChEBI: CHEBI:17858 IUPAC Name: 2-amino-4-[(2-{[2-(4-amino-4-carboxybutanamido)-2-[(carboxymethyl)carbamoyl]ethyl]disulfanyl}-1-[(carboxymethyl)carbamoyl]ethyl)carbamoyl]butanoic acid SMILES: N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O
| PubChem CID | 65359 |
|---|---|
| CAS | 27025-41-8 |
| Molecular Weight (g/mol) | 612.63 |
| ChEBI | CHEBI:17858 |
| MDL Number | MFCD00150701 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Synonym | oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized |
| IUPAC Name | 2-amino-4-[(2-{[2-(4-amino-4-carboxybutanamido)-2-[(carboxymethyl)carbamoyl]ethyl]disulfanyl}-1-[(carboxymethyl)carbamoyl]ethyl)carbamoyl]butanoic acid |
| InChI Key | YPZRWBKMTBYPTK-IOKZUGQQNA-N |
| Molecular Formula | C20H32N6O12S2 |
Vinyl acetate, 99+%, stabilized
CAS: 108-05-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 InChI Key: XTXRWKRVRITETP-UHFFFAOYSA-N Synonym: vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer PubChem CID: 7904 ChEBI: CHEBI:46916 IUPAC Name: ethenyl acetate SMILES: CC(=O)OC=C
| PubChem CID | 7904 |
|---|---|
| CAS | 108-05-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:46916 |
| SMILES | CC(=O)OC=C |
| Synonym | vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer |
| IUPAC Name | ethenyl acetate |
| InChI Key | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
2,6-Diaminopimelic acid, 96%
CAS: 583-93-7 Molecular Formula: C7H14N2O4 Molecular Weight (g/mol): 190.199 MDL Number: MFCD00002637 InChI Key: GMKMEZVLHJARHF-UHFFFAOYSA-N Synonym: 2,6-diaminopimelic acid,heptanedioic acid, 2,6-diamino,diaminopimelic acid,dl-2,6-diaminoheptanedioic acid,m-dap,dl-alpha,epsilon-diaminopimelic acid,1,5-diaminoheptanedioic acid,ll-diaminopimelate,d,l-diaminopimelate,ll-a2pm PubChem CID: 865 ChEBI: CHEBI:23673 IUPAC Name: 2,6-diaminoheptanedioic acid SMILES: C(CC(C(=O)O)N)CC(C(=O)O)N
| PubChem CID | 865 |
|---|---|
| CAS | 583-93-7 |
| Molecular Weight (g/mol) | 190.199 |
| ChEBI | CHEBI:23673 |
| MDL Number | MFCD00002637 |
| SMILES | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Synonym | 2,6-diaminopimelic acid,heptanedioic acid, 2,6-diamino,diaminopimelic acid,dl-2,6-diaminoheptanedioic acid,m-dap,dl-alpha,epsilon-diaminopimelic acid,1,5-diaminoheptanedioic acid,ll-diaminopimelate,d,l-diaminopimelate,ll-a2pm |
| IUPAC Name | 2,6-diaminoheptanedioic acid |
| InChI Key | GMKMEZVLHJARHF-UHFFFAOYSA-N |
| Molecular Formula | C7H14N2O4 |
4-Methyl-2-pentanone, 99%
CAS: 108-10-1 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.161 MDL Number: MFCD00008938 InChI Key: NTIZESTWPVYFNL-UHFFFAOYSA-N Synonym: 4-methyl-2-pentanone,methyl isobutyl ketone,isopropylacetone,isobutyl methyl ketone,hexone,mibk,2-pentanone, 4-methyl,2-methyl-4-pentanone,4-methyl-2-oxopentane,methylisobutylketon PubChem CID: 7909 ChEBI: CHEBI:82344 IUPAC Name: 4-methylpentan-2-one SMILES: CC(C)CC(=O)C
| PubChem CID | 7909 |
|---|---|
| CAS | 108-10-1 |
| Molecular Weight (g/mol) | 100.161 |
| ChEBI | CHEBI:82344 |
| MDL Number | MFCD00008938 |
| SMILES | CC(C)CC(=O)C |
| Synonym | 4-methyl-2-pentanone,methyl isobutyl ketone,isopropylacetone,isobutyl methyl ketone,hexone,mibk,2-pentanone, 4-methyl,2-methyl-4-pentanone,4-methyl-2-oxopentane,methylisobutylketon |
| IUPAC Name | 4-methylpentan-2-one |
| InChI Key | NTIZESTWPVYFNL-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |
Thermo Scientific Chemicals D-(+)-Glucose monohydrate
CAS: 14431-43-7 Molecular Formula: C6H12O6·H2O MDL Number: MFCD00149450
| CAS | 14431-43-7 |
|---|---|
| MDL Number | MFCD00149450 |
| Molecular Formula | C6H12O6·H2O |
Butyl acrylate, 99+%, stabilized
CAS: 141-32-2 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00009446 InChI Key: CQEYYJKEWSMYFG-UHFFFAOYSA-N Synonym: butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove PubChem CID: 8846 ChEBI: CHEBI:3245 IUPAC Name: butyl prop-2-enoate SMILES: CCCCOC(=O)C=C
| PubChem CID | 8846 |
|---|---|
| CAS | 141-32-2 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:3245 |
| MDL Number | MFCD00009446 |
| SMILES | CCCCOC(=O)C=C |
| Synonym | butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove |
| IUPAC Name | butyl prop-2-enoate |
| InChI Key | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Tri-n-butyl phosphate, 98%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
(Trimethylsilyl)diazomethane, 1.8 to 2.4M solution in hexanes
CAS: 18107-18-1 Molecular Formula: C4H10N2Si Molecular Weight (g/mol): 114.22 InChI Key: ONDSBJMLAHVLMI-UHFFFAOYSA-N Synonym: trimethylsilyl diazomethane,trimethylsilyldiazomethane,diazomethyl trimethylsilane,tms-diazomethane,diazomethyl trimethyl silane,tmschn2,silane, diazomethyl trimethyl,unii-qi98hqo8c4,diazomethyl-trimethyl-silane,qi98hqo8c4 PubChem CID: 167693 IUPAC Name: diazomethyl(trimethyl)silane SMILES: C[Si](C)(C)C=[N+]=[N-]
| PubChem CID | 167693 |
|---|---|
| CAS | 18107-18-1 |
| Molecular Weight (g/mol) | 114.22 |
| SMILES | C[Si](C)(C)C=[N+]=[N-] |
| Synonym | trimethylsilyl diazomethane,trimethylsilyldiazomethane,diazomethyl trimethylsilane,tms-diazomethane,diazomethyl trimethyl silane,tmschn2,silane, diazomethyl trimethyl,unii-qi98hqo8c4,diazomethyl-trimethyl-silane,qi98hqo8c4 |
| IUPAC Name | diazomethyl(trimethyl)silane |
| InChI Key | ONDSBJMLAHVLMI-UHFFFAOYSA-N |
| Molecular Formula | C4H10N2Si |
Potassium oxalate monohydrate, 99%, ACS reagent
CAS: 6487-48-5 Molecular Formula: C2H2K2O5 Molecular Weight (g/mol): 184.23 MDL Number: MFCD00150033 InChI Key: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC Name: dipotassium;oxalate;hydrate SMILES: O.[K+].[K+].[O-]C(=O)C([O-])=O
| PubChem CID | 2724193 |
|---|---|
| CAS | 6487-48-5 |
| Molecular Weight (g/mol) | 184.23 |
| MDL Number | MFCD00150033 |
| SMILES | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| IUPAC Name | dipotassium;oxalate;hydrate |
| InChI Key | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molecular Formula | C2H2K2O5 |